C17H17Br2ClN2O6S — CID 51355985
2-(4-chlorophenyl)-4-(dibromomethyl)-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazole-5-carboxamide (PubChem CID 51355985) has the molecular formula C17H17Br2ClN2O6S and a molecular weight of 572.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(dibromomethyl)-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-4-(dibromomethyl)-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 51355985 |
| Molecular Formula | C17H17Br2ClN2O6S |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 569.89 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(dibromomethyl)-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1sc(-c2ccc(Cl)cc2)nc1C(Br)Br |
| InChI | InChI=1S/C17H17Br2ClN2O6S/c18-14(19)9-13(29-17(21-9)6-1-3-7(20)4-2-6)15(27)22-16-12(26)11(25)10(24)8(5-23)28-16/h1-4,8,10-12,14,16,23-26H,5H2,(H,22,27)/t8-,10-,11+,12-,16?/m1/s1 |
| InChIKey | FUALBTGMWCCYMO-FNEAIZBHSA-N |
| XLogP | 1.78 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|