C37H56O6Si — CID 51356796
tert-butyl-[(E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enoxy]-dimethylsilane (PubChem CID 51356796) has the molecular formula C37H56O6Si and a molecular weight of 624.94 g/mol. Its IUPAC name is tert-butyl-[(E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 51356796 |
| Molecular Formula | C37H56O6Si |
| Molecular Weight | 624.94 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | tert-butyl-[(E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enoxy]-dimethylsilane |
| SMILES | COc1ccc(CO[C@H](C[C@@H]2CCC=C(C(C)(C)/C=C/CO[Si](C)(C)C(C)(C)C)O2)[C@@H](C)OCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H56O6Si/c1-29(41-28-39-26-30-15-11-10-12-16-30)34(40-27-31-19-21-32(38-7)22-20-31)25-33-17-13-18-35(43-33)37(5,6)23-14-24-42-44(8,9)36(2,3)4/h10-12,14-16,18-23,29,33-34H,13,17,24-28H2,1-9H3/b23-14+/t29-,33+,34-/m1/s1 |
| InChIKey | BRDJNFRWDWSJTG-AHDMPEKDSA-N |
| XLogP | 9.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.94 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|