C36H60O6Si2 — CID 134831708
[2-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]-5-tri(propan-2-yl)silyloxyphenoxy]-tri(propan-2-yl)silane (PubChem CID 134831708) has the molecular formula C36H60O6Si2 and a molecular weight of 645.04 g/mol. Its IUPAC name is [2-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]-5-tri(propan-2-yl)silyloxyphenoxy]-tri(propan-2-yl)silane.
| Compound Name | [2-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]-5-tri(propan-2-yl)silyloxyphenoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134831708 |
| Molecular Formula | C36H60O6Si2 |
| Molecular Weight | 645.04 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | [2-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]-5-tri(propan-2-yl)silyloxyphenoxy]-tri(propan-2-yl)silane |
| SMILES | COCOc1cc(/C=C/c2ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc2O[Si](C(C)C)(C(C)C)C(C)C)cc(OCOC)c1 |
| InChI | InChI=1S/C36H60O6Si2/c1-25(2)43(26(3)4,27(5)6)41-33-18-17-32(36(22-33)42-44(28(7)8,29(9)10)30(11)12)16-15-31-19-34(39-23-37-13)21-35(20-31)40-24-38-14/h15-22,25-30H,23-24H2,1-14H3/b16-15+ |
| InChIKey | MWNURRYSQHLJJO-FOCLMDBBSA-N |
| XLogP | 10.93 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.04 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|