C25H39NO3S2Si — CID 51357212
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one (PubChem CID 51357212) has the molecular formula C25H39NO3S2Si and a molecular weight of 493.81 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 51357212 |
| Molecular Formula | C25H39NO3S2Si |
| Molecular Weight | 493.81 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]pent-4-en-1-one |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COCc1ccccc1)C(=O)N1C(=S)SC[C@@H]1C(C)C |
| InChI | InChI=1S/C25H39NO3S2Si/c1-9-22(29-32(7,8)25(4,5)6)20(16-28-15-19-13-11-10-12-14-19)23(27)26-21(18(2)3)17-31-24(26)30/h9-14,18,20-22H,1,15-17H2,2-8H3/t20-,21-,22+/m1/s1 |
| InChIKey | FVOQWUDMFTUQIH-VSKRKVRLSA-N |
| XLogP | 6.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.81 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|