C25H22N2O2S — CID 51357705
2-(4-methylphenyl)sulfonyl-5-phenyl-3,10-dihydro-1H-azepino[3,4-b]indole (PubChem CID 51357705) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-5-phenyl-3,10-dihydro-1H-azepino[3,4-b]indole.
| Compound Name | 2-(4-methylphenyl)sulfonyl-5-phenyl-3,10-dihydro-1H-azepino[3,4-b]indole |
|---|---|
| PubChem CID | 51357705 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-5-phenyl-3,10-dihydro-1H-azepino[3,4-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C(c3ccccc3)c3c([nH]c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C25H22N2O2S/c1-18-11-13-20(14-12-18)30(28,29)27-16-15-21(19-7-3-2-4-8-19)25-22-9-5-6-10-23(22)26-24(25)17-27/h2-15,26H,16-17H2,1H3 |
| InChIKey | VVSRHCOURJXQGP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |