C32H26N4O6S2 — CID 177442361
22-(4-methylphenyl)sulfonyl-12-(2-nitrophenyl)sulfonyl-9,12,22-triazapentacyclo[13.7.0.02,10.03,8.016,21]docosa-1(15),2(10),3,5,7,16,18,20-octaene (PubChem CID 177442361) has the molecular formula C32H26N4O6S2 and a molecular weight of 626.72 g/mol. Its IUPAC name is 22-(4-methylphenyl)sulfonyl-12-(2-nitrophenyl)sulfonyl-9,12,22-triazapentacyclo[13.7.0.02,10.03,8.016,21]docosa-1(15),2(10),3,5,7,16,18,20-octaene.
| Compound Name | 22-(4-methylphenyl)sulfonyl-12-(2-nitrophenyl)sulfonyl-9,12,22-triazapentacyclo[13.7.0.02,10.03,8.016,21]docosa-1(15),2(10),3,5,7,16,18,20-octaene |
|---|---|
| PubChem CID | 177442361 |
| Molecular Formula | C32H26N4O6S2 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | 22-(4-methylphenyl)sulfonyl-12-(2-nitrophenyl)sulfonyl-9,12,22-triazapentacyclo[13.7.0.02,10.03,8.016,21]docosa-1(15),2(10),3,5,7,16,18,20-octaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2[nH]c4ccccc4c2-3)cc1 |
| InChI | InChI=1S/C32H26N4O6S2/c1-21-14-16-22(17-15-21)43(39,40)35-28-11-5-3-8-23(28)24-18-19-34(44(41,42)30-13-7-6-12-29(30)36(37)38)20-27-31(32(24)35)25-9-2-4-10-26(25)33-27/h2-17,33H,18-20H2,1H3 |
| InChIKey | JBIIAIIGQPLLBM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|