C24H21N3O4S — CID 177385748
17-methyl-10-(2-nitrophenyl)sulfonyl-10,13-diazatetracyclo[10.7.0.02,7.014,19]nonadeca-1(12),2,4,6,14(19),15,17-heptaene (PubChem CID 177385748) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 17-methyl-10-(2-nitrophenyl)sulfonyl-10,13-diazatetracyclo[10.7.0.02,7.014,19]nonadeca-1(12),2,4,6,14(19),15,17-heptaene.
| Compound Name | 17-methyl-10-(2-nitrophenyl)sulfonyl-10,13-diazatetracyclo[10.7.0.02,7.014,19]nonadeca-1(12),2,4,6,14(19),15,17-heptaene |
|---|---|
| PubChem CID | 177385748 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 17-methyl-10-(2-nitrophenyl)sulfonyl-10,13-diazatetracyclo[10.7.0.02,7.014,19]nonadeca-1(12),2,4,6,14(19),15,17-heptaene |
| SMILES | Cc1ccc2[nH]c3c(c2c1)-c1ccccc1CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])C3 |
| InChI | InChI=1S/C24H21N3O4S/c1-16-10-11-20-19(14-16)24-18-7-3-2-6-17(18)12-13-26(15-21(24)25-20)32(30,31)23-9-5-4-8-22(23)27(28)29/h2-11,14,25H,12-13,15H2,1H3 |
| InChIKey | AUMCLWBGXOXCCR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|