C15H19NO7 — CID 51358852
(1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol (PubChem CID 51358852) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is (1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol.
| Compound Name | (1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 51358852 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCO[C@@]21O[C@H](CCO)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19NO7/c17-5-3-11-8-13(18)14(19)15(23-11)12-2-1-10(16(20)21)7-9(12)4-6-22-15/h1-2,7,11,13-14,17-19H,3-6,8H2/t11-,13+,14-,15-/m1/s1 |
| InChIKey | DIDPCCHMOSHRGR-FAAHXZRKSA-N |
| XLogP | 0.21 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|