C14H17NO7 — CID 51358847
(3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol (PubChem CID 51358847) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is (3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol.
| Compound Name | (3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 51358847 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (3R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-nitrospiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CO[C@@]21O[C@H](CCO)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17NO7/c16-4-3-10-6-12(17)13(18)14(22-10)11-2-1-9(15(19)20)5-8(11)7-21-14/h1-2,5,10,12-13,16-18H,3-4,6-7H2/t10-,12+,13-,14-/m1/s1 |
| InChIKey | YSNULCLLBGISAV-YXCITZCRSA-N |
| XLogP | 0.17 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|