C17H22N2O4 — CID 89112619
1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-nitro-2-prop-1-en-2-yl-2,3-dihydroindole (PubChem CID 89112619) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-nitro-2-prop-1-en-2-yl-2,3-dihydroindole.
| Compound Name | 1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-nitro-2-prop-1-en-2-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 89112619 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-5-nitro-2-prop-1-en-2-yl-2,3-dihydroindole |
| SMILES | C=C(C)C1Cc2cc([N+](=O)[O-])ccc2N1C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H22N2O4/c1-11(2)16-8-12-7-13(19(20)21)5-6-15(12)18(16)9-14-10-22-17(3,4)23-14/h5-7,14,16H,1,8-10H2,2-4H3/t14-,16?/m1/s1 |
| InChIKey | ALIHLZQBNUENJE-IURRXHLWSA-N |
| XLogP | 3.05 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|