C14H17F2N3O6 — CID 51361656
1-[(2R,3R,4S,5S)-5-(4,4-difluoropiperidine-1-carbonyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 51361656) has the molecular formula C14H17F2N3O6 and a molecular weight of 361.30 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-(4,4-difluoropiperidine-1-carbonyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-5-(4,4-difluoropiperidine-1-carbonyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51361656 |
| Molecular Formula | C14H17F2N3O6 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-(4,4-difluoropiperidine-1-carbonyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=C([C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H17F2N3O6/c15-14(16)2-5-18(6-3-14)11(23)10-8(21)9(22)12(25-10)19-4-1-7(20)17-13(19)24/h1,4,8-10,12,21-22H,2-3,5-6H2,(H,17,20,24)/t8-,9+,10-,12+/m0/s1 |
| InChIKey | JQDFOYOLKOJNIP-MIZYBKAJSA-N |
| XLogP | -1.59 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |