C16H24N4O7 — CID 51361713
[(2S,3S)-2-[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]-3-methylpentyl] formate (PubChem CID 51361713) has the molecular formula C16H24N4O7 and a molecular weight of 384.39 g/mol. Its IUPAC name is [(2S,3S)-2-[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]-3-methylpentyl] formate.
| Compound Name | [(2S,3S)-2-[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]-3-methylpentyl] formate |
|---|---|
| PubChem CID | 51361713 |
| Molecular Formula | C16H24N4O7 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(2S,3S)-2-[[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]-3-methylpentyl] formate |
| SMILES | CC[C@H](C)[C@@H](COC=O)NC(=O)[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H24N4O7/c1-3-8(2)9(6-26-7-21)18-14(24)13-11(22)12(23)15(27-13)20-5-4-10(17)19-16(20)25/h4-5,7-9,11-13,15,22-23H,3,6H2,1-2H3,(H,18,24)(H2,17,19,25)/t8-,9+,11-,12+,13-,15+/m0/s1 |
| InChIKey | XZEAWJOGTOTPGB-ZVSMKJGCSA-N |
| XLogP | -1.85 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|