About 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine
3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine (PubChem CID 51365951) has the molecular formula C21H15FN6
and a molecular weight of 370.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine |
| PubChem CID | 51365951 |
| Molecular Formula | C21H15FN6 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine |
| SMILES | Fc1ccc(-c2nnn3c2nc(NCc2ccncc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C21H15FN6/c22-16-7-5-15(6-8-16)19-21-25-20(24-13-14-9-11-23-12-10-14)17-3-1-2-4-18(17)28(21)27-26-19/h1-12H,13H2,(H,24,25) |
| InChIKey | STLQKLBHABFRJC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine?
The IUPAC name of 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine (CID 51365951) is 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine.
What is the SMILES notation for 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine?
The canonical SMILES for 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine is Fc1ccc(-c2nnn3c2nc(NCc2ccncc2)c2ccccc23)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine?
The InChIKey is STLQKLBHABFRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15FN6/c22-16-7-5-15(6-8-16)19-21-25-20(24-13-14-9-11-23-12-10-14)17-3-1-2-4-18(17)28(21)27-26-19/h1-12H,13H2,(H,24,25).
What are the key properties of 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine?
3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine has a molecular weight of 370.39 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)triazolo[1,5-a]quinazolin-5-amine is sourced from PubChem (CID 51365951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).