C22H15BrFN5O2S — CID 134787464
CID 134787464 (PubChem CID 134787464) has the molecular formula C22H15BrFN5O2S and a molecular weight of 512.36 g/mol.
| Compound Name | CID 134787464 |
|---|---|
| PubChem CID | 134787464 |
| Molecular Formula | C22H15BrFN5O2S |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(c1ccc(Br)cc1)c1nnn2c1nc(NCc1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C22H15BrFN5O2S/c23-15-7-11-17(12-8-15)32(30,31)22-21-26-20(25-13-14-5-9-16(24)10-6-14)18-3-1-2-4-19(18)29(21)28-27-22/h1-12H,13H2,(H-,25,26,30,31) |
| InChIKey | JASJPQXHDJOQMY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|