About CID 134787464
CID 134787464 (PubChem CID 134787464) has the molecular formula C22H15BrFN5O2S
and a molecular weight of 512.36 g/mol.
Molecular Properties
| Compound Name | CID 134787464 |
| PubChem CID | 134787464 |
| Molecular Formula | C22H15BrFN5O2S |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(c1ccc(Br)cc1)c1nnn2c1nc(NCc1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C22H15BrFN5O2S/c23-15-7-11-17(12-8-15)32(30,31)22-21-26-20(25-13-14-5-9-16(24)10-6-14)18-3-1-2-4-19(18)29(21)28-27-22/h1-12H,13H2,(H-,25,26,30,31) |
| InChIKey | JASJPQXHDJOQMY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134787464 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134787464?
The IUPAC name of CID 134787464 (CID 134787464) is not available.
What is the SMILES notation for CID 134787464?
The canonical SMILES for CID 134787464 is O=[S+]([O-])(c1ccc(Br)cc1)c1nnn2c1nc(NCc1ccc(F)cc1)c1ccccc12.
What is the InChIKey of CID 134787464?
The InChIKey is JASJPQXHDJOQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrFN5O2S/c23-15-7-11-17(12-8-15)32(30,31)22-21-26-20(25-13-14-5-9-16(24)10-6-14)18-3-1-2-4-19(18)29(21)28-27-22/h1-12H,13H2,(H-,25,26,30,31).
What are the key properties of CID 134787464?
CID 134787464 has a molecular weight of 512.36 g/mol, XLogP of 4.84, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134787464 is sourced from PubChem (CID 134787464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).