C23H18FN5O3S — CID 134789596
CID 134789596 (PubChem CID 134789596) has the molecular formula C23H18FN5O3S and a molecular weight of 463.49 g/mol.
| Compound Name | CID 134789596 |
|---|---|
| PubChem CID | 134789596 |
| Molecular Formula | C23H18FN5O3S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | — |
| SMILES | COc1ccc([S+](=O)([O-])c2nnn3c2nc(NCc2ccc(F)cc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C23H18FN5O3S/c1-32-17-10-12-18(13-11-17)33(30,31)23-22-26-21(25-14-15-6-8-16(24)9-7-15)19-4-2-3-5-20(19)29(22)28-27-23/h2-13H,14H2,1H3,(H-,25,26,30,31) |
| InChIKey | PANFGELPORQMGE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|