C11H16N3O5P — CID 513845
[(2S,3S,6R)-3-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-methyl-3,6-dihydro-2H-pyran-6-yl]phosphonic acid (PubChem CID 513845) has the molecular formula C11H16N3O5P and a molecular weight of 301.24 g/mol. Its IUPAC name is [(2S,3S,6R)-3-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-methyl-3,6-dihydro-2H-pyran-6-yl]phosphonic acid.
| Compound Name | [(2S,3S,6R)-3-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-methyl-3,6-dihydro-2H-pyran-6-yl]phosphonic acid |
|---|---|
| PubChem CID | 513845 |
| Molecular Formula | C11H16N3O5P |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [(2S,3S,6R)-3-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-methyl-3,6-dihydro-2H-pyran-6-yl]phosphonic acid |
| SMILES | Cc1cn([C@H]2C=C[C@@H](P(=O)(O)O)O[C@H]2C)c(=O)nc1N |
| InChI | InChI=1S/C11H16N3O5P/c1-6-5-14(11(15)13-10(6)12)8-3-4-9(19-7(8)2)20(16,17)18/h3-5,7-9H,1-2H3,(H2,12,13,15)(H2,16,17,18)/t7-,8-,9+/m0/s1 |
| InChIKey | OMGYHUJGENQCOM-XHNCKOQMSA-N |
| XLogP | 0.15 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|