C18H20ClN3O4S — CID 51391408
1-[[5-[(4-chlorophenoxy)methyl]furan-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 51391408) has the molecular formula C18H20ClN3O4S and a molecular weight of 409.90 g/mol. Its IUPAC name is 1-[[5-[(4-chlorophenoxy)methyl]furan-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[[5-[(4-chlorophenoxy)methyl]furan-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 51391408 |
| Molecular Formula | C18H20ClN3O4S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1-[[5-[(4-chlorophenoxy)methyl]furan-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | O=C(NNC(=S)NC[C@H]1CCCO1)c1ccc(COc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C18H20ClN3O4S/c19-12-3-5-13(6-4-12)25-11-15-7-8-16(26-15)17(23)21-22-18(27)20-10-14-2-1-9-24-14/h3-8,14H,1-2,9-11H2,(H,21,23)(H2,20,22,27)/t14-/m1/s1 |
| InChIKey | YQOBCIVAXXJQSA-CQSZACIVSA-N |
| XLogP | 2.80 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|