C17H10N4O5S3 — CID 5140340
3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5140340) has the molecular formula C17H10N4O5S3 and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5140340 |
| Molecular Formula | C17H10N4O5S3 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc([N+](=O)[O-])cc2)SC(=S)N1NC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H10N4O5S3/c22-16-13(9-10-5-7-11(8-6-10)21(23)24)28-17(27)20(16)18-15-12-3-1-2-4-14(12)29(25,26)19-15/h1-9H,(H,18,19) |
| InChIKey | UILBDULJGLLNTA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|