C17H10BrN3O3S3 — CID 6526217
(5Z)-5-[(3-bromophenyl)methylidene]-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6526217) has the molecular formula C17H10BrN3O3S3 and a molecular weight of 480.39 g/mol. Its IUPAC name is (5Z)-5-[(3-bromophenyl)methylidene]-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromophenyl)methylidene]-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6526217 |
| Molecular Formula | C17H10BrN3O3S3 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | (5Z)-5-[(3-bromophenyl)methylidene]-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccc(Br)c2)SC(=S)N1NC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H10BrN3O3S3/c18-11-5-3-4-10(8-11)9-13-16(22)21(17(25)26-13)19-15-12-6-1-2-7-14(12)27(23,24)20-15/h1-9H,(H,19,20)/b13-9- |
| InChIKey | IHWITLYVPLXXQV-LCYFTJDESA-N |
| XLogP | 3.30 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|