C25H27N5O3 — CID 5145457
[1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(5-methyl-1-phenylpyrazol-4-yl)methanolate (PubChem CID 5145457) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is [1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(5-methyl-1-phenylpyrazol-4-yl)methanolate.
| Compound Name | [1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(5-methyl-1-phenylpyrazol-4-yl)methanolate |
|---|---|
| PubChem CID | 5145457 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(5-methyl-1-phenylpyrazol-4-yl)methanolate |
| SMILES | Cc1c(C([O-])=C2C(=O)C(=O)N(CCC[NH+](C)C)C2c2cccnc2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C25H27N5O3/c1-17-20(16-27-30(17)19-10-5-4-6-11-19)23(31)21-22(18-9-7-12-26-15-18)29(25(33)24(21)32)14-8-13-28(2)3/h4-7,9-12,15-16,22,31H,8,13-14H2,1-3H3 |
| InChIKey | XYSNMVDDCBZGBE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|