C24H24N4O3 — CID 51468139
N-[2-(1H-indol-3-yl)ethyl]-N'-[(3R)-3-methyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl]oxamide (PubChem CID 51468139) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N'-[(3R)-3-methyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl]oxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[(3R)-3-methyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl]oxamide |
|---|---|
| PubChem CID | 51468139 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[(3R)-3-methyl-2-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl]oxamide |
| SMILES | C[C@H]1C(=O)N2CCCc3cc(NC(=O)C(=O)NCCc4c[nH]c5ccccc45)cc1c32 |
| InChI | InChI=1S/C24H24N4O3/c1-14-19-12-17(11-15-5-4-10-28(21(15)19)24(14)31)27-23(30)22(29)25-9-8-16-13-26-20-7-3-2-6-18(16)20/h2-3,6-7,11-14,26H,4-5,8-10H2,1H3,(H,25,29)(H,27,30)/t14-/m1/s1 |
| InChIKey | RHNJTTIJCQAXTK-CQSZACIVSA-N |
| XLogP | 2.86 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|