C16H16N4OS — CID 51495354
3-pyridin-2-yl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-1H-pyrazole-5-carboxamide (PubChem CID 51495354) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 3-pyridin-2-yl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-pyridin-2-yl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 51495354 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-pyridin-2-yl-N-[(2R)-1-thiophen-2-ylpropan-2-yl]-1H-pyrazole-5-carboxamide |
| SMILES | C[C@H](Cc1cccs1)NC(=O)c1cc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C16H16N4OS/c1-11(9-12-5-4-8-22-12)18-16(21)15-10-14(19-20-15)13-6-2-3-7-17-13/h2-8,10-11H,9H2,1H3,(H,18,21)(H,19,20)/t11-/m1/s1 |
| InChIKey | FNYXQSPGXHNHHL-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |