C25H24ClIN2O — CID 5149617
(4-chlorophenyl)-[2-ethyl-4-(4-iodoanilino)-3-methyl-3,4-dihydro-2H-quinolin-1-yl]methanone (PubChem CID 5149617) has the molecular formula C25H24ClIN2O and a molecular weight of 530.84 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-ethyl-4-(4-iodoanilino)-3-methyl-3,4-dihydro-2H-quinolin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[2-ethyl-4-(4-iodoanilino)-3-methyl-3,4-dihydro-2H-quinolin-1-yl]methanone |
|---|---|
| PubChem CID | 5149617 |
| Molecular Formula | C25H24ClIN2O |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | (4-chlorophenyl)-[2-ethyl-4-(4-iodoanilino)-3-methyl-3,4-dihydro-2H-quinolin-1-yl]methanone |
| SMILES | CCC1C(C)C(Nc2ccc(I)cc2)c2ccccc2N1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClIN2O/c1-3-22-16(2)24(28-20-14-12-19(27)13-15-20)21-6-4-5-7-23(21)29(22)25(30)17-8-10-18(26)11-9-17/h4-16,22,24,28H,3H2,1-2H3 |
| InChIKey | UWFOWQUZEJOLCF-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|