C20H17FN4O3 — CID 51498707
(4S,5S)-3-(4-fluorophenyl)-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 51498707) has the molecular formula C20H17FN4O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is (4S,5S)-3-(4-fluorophenyl)-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (4S,5S)-3-(4-fluorophenyl)-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 51498707 |
| Molecular Formula | C20H17FN4O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (4S,5S)-3-(4-fluorophenyl)-4-methyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | C[C@H]1C(c2ccc(F)cc2)=NO[C@@H]1C(=O)NCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C20H17FN4O3/c1-12-17(13-7-9-15(21)10-8-13)24-28-18(12)20(26)22-11-16-23-19(25-27-16)14-5-3-2-4-6-14/h2-10,12,18H,11H2,1H3,(H,22,26)/t12-,18-/m0/s1 |
| InChIKey | IFMHQTADZLYOBM-SGTLLEGYSA-N |
| XLogP | 2.93 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |