C23H24N2O2 — CID 51513517
(3aS,7aR)-2-[[benzhydryl(methyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 51513517) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (3aS,7aR)-2-[[benzhydryl(methyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[[benzhydryl(methyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 51513517 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (3aS,7aR)-2-[[benzhydryl(methyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CN(CN1C(=O)[C@H]2CC=CC[C@H]2C1=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c1-24(16-25-22(26)19-14-8-9-15-20(19)23(25)27)21(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-13,19-21H,14-16H2,1H3/t19-,20+ |
| InChIKey | STGZTOKYIHBLQL-BGYRXZFFSA-N |
| XLogP | 3.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|