C22H21N3 — CID 51521223
4-[(Z)-2-phenylethenyl]-2-[(E)-2-phenylethenyl]benzene-1,3,5-triamine (PubChem CID 51521223) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[(Z)-2-phenylethenyl]-2-[(E)-2-phenylethenyl]benzene-1,3,5-triamine.
| Compound Name | 4-[(Z)-2-phenylethenyl]-2-[(E)-2-phenylethenyl]benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 51521223 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-[(Z)-2-phenylethenyl]-2-[(E)-2-phenylethenyl]benzene-1,3,5-triamine |
| SMILES | Nc1cc(N)c(/C=C/c2ccccc2)c(N)c1/C=C\c1ccccc1 |
| InChI | InChI=1S/C22H21N3/c23-20-15-21(24)19(14-12-17-9-5-2-6-10-17)22(25)18(20)13-11-16-7-3-1-4-8-16/h1-15H,23-25H2/b13-11-,14-12+ |
| InChIKey | NYTACRUTGWIIQX-HEEUSZRZSA-N |
| XLogP | 4.77 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|