C15H13N5O3 — CID 51525371
[(E)-[amino(pyrazolo[1,5-a]pyrimidin-3-yl)methylidene]amino] 4-methoxybenzoate (PubChem CID 51525371) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is [(E)-[amino(pyrazolo[1,5-a]pyrimidin-3-yl)methylidene]amino] 4-methoxybenzoate.
| Compound Name | [(E)-[amino(pyrazolo[1,5-a]pyrimidin-3-yl)methylidene]amino] 4-methoxybenzoate |
|---|---|
| PubChem CID | 51525371 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | [(E)-[amino(pyrazolo[1,5-a]pyrimidin-3-yl)methylidene]amino] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O/N=C(/N)c2cnn3cccnc23)cc1 |
| InChI | InChI=1S/C15H13N5O3/c1-22-11-5-3-10(4-6-11)15(21)23-19-13(16)12-9-18-20-8-2-7-17-14(12)20/h2-9H,1H3,(H2,16,19) |
| InChIKey | ZQBBMGCVMBXQSN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|