C24H19N5O2 — CID 5154003
12-imino-4-phenyl-9-pyridin-4-yl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 5154003) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 12-imino-4-phenyl-9-pyridin-4-yl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | 12-imino-4-phenyl-9-pyridin-4-yl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 5154003 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 12-imino-4-phenyl-9-pyridin-4-yl-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCC(c4ccccc4)CC2C1(C#N)C(C#N)(C#N)C(c1ccncc1)O3 |
| InChI | InChI=1S/C24H19N5O2/c25-13-22(14-26)20(17-7-10-29-11-8-17)30-24-9-6-18(16-4-2-1-3-5-16)12-19(24)23(22,15-27)21(28)31-24/h1-5,7-8,10-11,18-20,28H,6,9,12H2/b28-21+ |
| InChIKey | KSKXWBMZMRENCK-SGWCAAJKSA-N |
| XLogP | 3.98 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|