C14H16N4OS2 — CID 51546474
7-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 51546474) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 7-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 51546474 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 7-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(CSC2=N[C@@H]3CCCC[C@H]3N2)nc2sccn12 |
| InChI | InChI=1S/C14H16N4OS2/c19-12-7-9(15-14-18(12)5-6-20-14)8-21-13-16-10-3-1-2-4-11(10)17-13/h5-7,10-11H,1-4,8H2,(H,16,17)/t10-,11-/m1/s1 |
| InChIKey | LGEQWOAUPKEQHP-GHMZBOCLSA-N |
| XLogP | 2.26 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |