C22H18N4O4 — CID 5155941
2-[[1-(3-acetyl-1H-indol-5-yl)ethenylamino]carbamoyl]-1H-indole-7-carboxylic acid (PubChem CID 5155941) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 2-[[1-(3-acetyl-1H-indol-5-yl)ethenylamino]carbamoyl]-1H-indole-7-carboxylic acid.
| Compound Name | 2-[[1-(3-acetyl-1H-indol-5-yl)ethenylamino]carbamoyl]-1H-indole-7-carboxylic acid |
|---|---|
| PubChem CID | 5155941 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[[1-(3-acetyl-1H-indol-5-yl)ethenylamino]carbamoyl]-1H-indole-7-carboxylic acid |
| SMILES | C=C(NNC(=O)c1cc2cccc(C(=O)O)c2[nH]1)c1ccc2[nH]cc(C(C)=O)c2c1 |
| InChI | InChI=1S/C22H18N4O4/c1-11(13-6-7-18-16(8-13)17(10-23-18)12(2)27)25-26-21(28)19-9-14-4-3-5-15(22(29)30)20(14)24-19/h3-10,23-25H,1H2,2H3,(H,26,28)(H,29,30) |
| InChIKey | QQMIPVWRWQYMKZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|