C18H14N2O2 — CID 12515702
1-(6-acetyl-3,8-dihydroindolo[7,6-g]indol-2-yl)ethanone (PubChem CID 12515702) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-(6-acetyl-3,8-dihydroindolo[7,6-g]indol-2-yl)ethanone.
| Compound Name | 1-(6-acetyl-3,8-dihydroindolo[7,6-g]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 12515702 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-(6-acetyl-3,8-dihydroindolo[7,6-g]indol-2-yl)ethanone |
| SMILES | CC(=O)c1cc2ccc3c(ccc4c(C(C)=O)c[nH]c43)c2[nH]1 |
| InChI | InChI=1S/C18H14N2O2/c1-9(21)15-8-19-18-13-4-3-11-7-16(10(2)22)20-17(11)12(13)5-6-14(15)18/h3-8,19-20H,1-2H3 |
| InChIKey | QNZWGPOSOINCJH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |