C26H23Cl2N3O2 — CID 5156115
3,4-dichloro-N-[2-[[(4-phenylcyclohexylidene)amino]carbamoyl]phenyl]benzamide (PubChem CID 5156115) has the molecular formula C26H23Cl2N3O2 and a molecular weight of 480.40 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[(4-phenylcyclohexylidene)amino]carbamoyl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[(4-phenylcyclohexylidene)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 5156115 |
| Molecular Formula | C26H23Cl2N3O2 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 3,4-dichloro-N-[2-[[(4-phenylcyclohexylidene)amino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NN=C1CCC(c2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H23Cl2N3O2/c27-22-15-12-19(16-23(22)28)25(32)29-24-9-5-4-8-21(24)26(33)31-30-20-13-10-18(11-14-20)17-6-2-1-3-7-17/h1-9,12,15-16,18H,10-11,13-14H2,(H,29,32)(H,31,33)/b30-20- |
| InChIKey | ITOHKOUJFSBRMR-COEJQBHMSA-N |
| XLogP | 6.69 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|