C9H17NO2 — CID 5157700
4-(2-methoxyethoxy)-N,N-dimethylbut-2-yn-1-amine (PubChem CID 5157700) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N,N-dimethylbut-2-yn-1-amine.
| Compound Name | 4-(2-methoxyethoxy)-N,N-dimethylbut-2-yn-1-amine |
|---|---|
| PubChem CID | 5157700 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 4-(2-methoxyethoxy)-N,N-dimethylbut-2-yn-1-amine |
| SMILES | COCCOCC#CCN(C)C |
| InChI | InChI=1S/C9H17NO2/c1-10(2)6-4-5-7-12-9-8-11-3/h6-9H2,1-3H3 |
| InChIKey | VGWNAONWFUTXSL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|