About 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate
2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate (PubChem CID 515927) has the molecular formula C14H15ClN2O5S
and a molecular weight of 358.80 g/mol. Its IUPAC name is 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate |
| PubChem CID | 515927 |
| Molecular Formula | C14H15ClN2O5S |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate |
| SMILES | COCCOC(=O)c1cccn1S(=O)(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C14H15ClN2O5S/c1-21-7-8-22-14(18)12-3-2-6-17(12)23(19,20)13-9-10(15)4-5-11(13)16/h2-6,9H,7-8,16H2,1H3 |
| InChIKey | BHXPMUSVORIGJR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate?
The IUPAC name of 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate (CID 515927) is 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate.
What is the SMILES notation for 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate?
The canonical SMILES for 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate is COCCOC(=O)c1cccn1S(=O)(=O)c1cc(Cl)ccc1N.
What is the InChIKey of 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate?
The InChIKey is BHXPMUSVORIGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O5S/c1-21-7-8-22-14(18)12-3-2-6-17(12)23(19,20)13-9-10(15)4-5-11(13)16/h2-6,9H,7-8,16H2,1H3.
What are the key properties of 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate?
2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate has a molecular weight of 358.80 g/mol, XLogP of 1.76, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate is sourced from PubChem (CID 515927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).