C22H24FN3O2 — CID 51593462
N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]propanamide (PubChem CID 51593462) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]propanamide.
| Compound Name | N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]propanamide |
|---|---|
| PubChem CID | 51593462 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]-3-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]propanamide |
| SMILES | C[C@@H]1Cc2cc(CCC(=O)NCCCc3nc4ccc(F)cc4[nH]3)ccc2O1 |
| InChI | InChI=1S/C22H24FN3O2/c1-14-11-16-12-15(4-8-20(16)28-14)5-9-22(27)24-10-2-3-21-25-18-7-6-17(23)13-19(18)26-21/h4,6-8,12-14H,2-3,5,9-11H2,1H3,(H,24,27)(H,25,26)/t14-/m1/s1 |
| InChIKey | AWWPCMBCWDDEFE-CQSZACIVSA-N |
| XLogP | 3.71 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|