C27H26N4O4 — CID 5160185
N'-[[2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)butanediamide (PubChem CID 5160185) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is N'-[[2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)butanediamide.
| Compound Name | N'-[[2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 5160185 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N'-[[2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-N-(4-ethoxyphenyl)butanediamide |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)NN=Cc2ccccc2OCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C27H26N4O4/c1-2-34-24-13-11-23(12-14-24)30-26(32)15-16-27(33)31-29-18-21-8-5-6-10-25(21)35-19-22-9-4-3-7-20(22)17-28/h3-14,18H,2,15-16,19H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | QVVVYYGJVIAQBX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|