C25H19Cl2N5O4S2 — CID 5160831
N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 5160831) has the molecular formula C25H19Cl2N5O4S2 and a molecular weight of 588.50 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5160831 |
| Molecular Formula | C25H19Cl2N5O4S2 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.03 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methylideneamino]-2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2sc3c(c2c(=O)n1-c1ccc(Cl)cc1)CCCC3)NN=Cc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C25H19Cl2N5O4S2/c26-15-5-7-16(8-6-15)31-24(34)22-18-3-1-2-4-20(18)38-23(22)29-25(31)37-13-21(33)30-28-12-14-11-17(32(35)36)9-10-19(14)27/h5-12H,1-4,13H2,(H,30,33) |
| InChIKey | FKCCEIOXEXIOIW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|