C24H36N2O3 — CID 51608389
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(1-adamantyl)propyl]propanamide (PubChem CID 51608389) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(1-adamantyl)propyl]propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(1-adamantyl)propyl]propanamide |
|---|---|
| PubChem CID | 51608389 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(1-adamantyl)propyl]propanamide |
| SMILES | CC[C@H](NC(=O)CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H36N2O3/c1-2-20(24-12-15-9-16(13-24)11-17(10-15)14-24)25-21(27)7-8-26-22(28)18-5-3-4-6-19(18)23(26)29/h15-20H,2-14H2,1H3,(H,25,27)/t15?,16?,17?,18-,19+,20-,24?/m0/s1 |
| InChIKey | AHPNRCUJTWJFJA-LASWRBMDSA-N |
| XLogP | 3.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|