C8H3BrClNO2S — CID 5161407
8-bromo-6-chloro-2-sulfanylidene-1,3-benzoxazin-4-one (PubChem CID 5161407) has the molecular formula C8H3BrClNO2S and a molecular weight of 292.54 g/mol. Its IUPAC name is 8-bromo-6-chloro-2-sulfanylidene-1,3-benzoxazin-4-one.
| Compound Name | 8-bromo-6-chloro-2-sulfanylidene-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 5161407 |
| Molecular Formula | C8H3BrClNO2S |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 290.88 |
| IUPAC Name | 8-bromo-6-chloro-2-sulfanylidene-1,3-benzoxazin-4-one |
| SMILES | O=c1[nH]c(=S)oc2c(Br)cc(Cl)cc12 |
| InChI | InChI=1S/C8H3BrClNO2S/c9-5-2-3(10)1-4-6(5)13-8(14)11-7(4)12/h1-2H,(H,11,12,14) |
| InChIKey | DODJTZYKMROXQE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|