C14H10ClNO3S — CID 87717017
11-chloro-2-sulfanylidene-6,7,8,9-tetrahydro-3H-isochromeno[3,4-e][1,3]benzoxazol-5-one (PubChem CID 87717017) has the molecular formula C14H10ClNO3S and a molecular weight of 307.76 g/mol. Its IUPAC name is 11-chloro-2-sulfanylidene-6,7,8,9-tetrahydro-3H-isochromeno[3,4-e][1,3]benzoxazol-5-one.
| Compound Name | 11-chloro-2-sulfanylidene-6,7,8,9-tetrahydro-3H-isochromeno[3,4-e][1,3]benzoxazol-5-one |
|---|---|
| PubChem CID | 87717017 |
| Molecular Formula | C14H10ClNO3S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 11-chloro-2-sulfanylidene-6,7,8,9-tetrahydro-3H-isochromeno[3,4-e][1,3]benzoxazol-5-one |
| SMILES | O=c1oc2c(cc(Cl)c3oc(=S)[nH]c32)c2c1CCCC2 |
| InChI | InChI=1S/C14H10ClNO3S/c15-9-5-8-6-3-1-2-4-7(6)13(17)18-11(8)10-12(9)19-14(20)16-10/h5H,1-4H2,(H,16,20) |
| InChIKey | GUYXRDXXHIUCAH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|