C23H23ClNO3+ — CID 2014073
12-chloro-3-[(4-methylphenyl)methyl]-3,4,7,8,9,10-hexahydro-2H-isochromeno[3,4-f][1,3]benzoxazin-3-ium-6-one (PubChem CID 2014073) has the molecular formula C23H23ClNO3+ and a molecular weight of 396.89 g/mol. Its IUPAC name is 12-chloro-3-[(4-methylphenyl)methyl]-3,4,7,8,9,10-hexahydro-2H-isochromeno[3,4-f][1,3]benzoxazin-3-ium-6-one.
| Compound Name | 12-chloro-3-[(4-methylphenyl)methyl]-3,4,7,8,9,10-hexahydro-2H-isochromeno[3,4-f][1,3]benzoxazin-3-ium-6-one |
|---|---|
| PubChem CID | 2014073 |
| Molecular Formula | C23H23ClNO3+ |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 12-chloro-3-[(4-methylphenyl)methyl]-3,4,7,8,9,10-hexahydro-2H-isochromeno[3,4-f][1,3]benzoxazin-3-ium-6-one |
| SMILES | Cc1ccc(C[NH+]2COc3c(Cl)cc4c5c(c(=O)oc4c3C2)CCCC5)cc1 |
| InChI | InChI=1S/C23H22ClNO3/c1-14-6-8-15(9-7-14)11-25-12-19-21-18(10-20(24)22(19)27-13-25)16-4-2-3-5-17(16)23(26)28-21/h6-10H,2-5,11-13H2,1H3/p+1 |
| InChIKey | NRFBXHKMQXXONI-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|