C23H18ClN2O3+ — CID 7645821
6-chloro-4-phenyl-9-(pyridin-4-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one (PubChem CID 7645821) has the molecular formula C23H18ClN2O3+ and a molecular weight of 405.86 g/mol. Its IUPAC name is 6-chloro-4-phenyl-9-(pyridin-4-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one.
| Compound Name | 6-chloro-4-phenyl-9-(pyridin-4-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
|---|---|
| PubChem CID | 7645821 |
| Molecular Formula | C23H18ClN2O3+ |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 6-chloro-4-phenyl-9-(pyridin-4-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
| SMILES | O=c1cc(-c2ccccc2)c2cc(Cl)c3c(c2o1)C[NH+](Cc1ccncc1)CO3 |
| InChI | InChI=1S/C23H17ClN2O3/c24-20-10-18-17(16-4-2-1-3-5-16)11-21(27)29-22(18)19-13-26(14-28-23(19)20)12-15-6-8-25-9-7-15/h1-11H,12-14H2/p+1 |
| InChIKey | QZJANLCSKNPLKE-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 56.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|