C18H17ClNO4+ — CID 7274471
6-chloro-4-ethyl-9-(furan-2-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one (PubChem CID 7274471) has the molecular formula C18H17ClNO4+ and a molecular weight of 346.79 g/mol. Its IUPAC name is 6-chloro-4-ethyl-9-(furan-2-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one.
| Compound Name | 6-chloro-4-ethyl-9-(furan-2-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
|---|---|
| PubChem CID | 7274471 |
| Molecular Formula | C18H17ClNO4+ |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 6-chloro-4-ethyl-9-(furan-2-ylmethyl)-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
| SMILES | CCc1cc(=O)oc2c3c(c(Cl)cc12)OC[NH+](Cc1ccco1)C3 |
| InChI | InChI=1S/C18H16ClNO4/c1-2-11-6-16(21)24-17-13(11)7-15(19)18-14(17)9-20(10-23-18)8-12-4-3-5-22-12/h3-7H,2,8-10H2,1H3/p+1 |
| InChIKey | AYJIHHVIWKVFRU-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 57.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|