C24H21ClNO4+ — CID 2010974
3-benzyl-6-chloro-9-(furan-2-ylmethyl)-4-methyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one (PubChem CID 2010974) has the molecular formula C24H21ClNO4+ and a molecular weight of 422.89 g/mol. Its IUPAC name is 3-benzyl-6-chloro-9-(furan-2-ylmethyl)-4-methyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one.
| Compound Name | 3-benzyl-6-chloro-9-(furan-2-ylmethyl)-4-methyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
|---|---|
| PubChem CID | 2010974 |
| Molecular Formula | C24H21ClNO4+ |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 3-benzyl-6-chloro-9-(furan-2-ylmethyl)-4-methyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c3c(c(Cl)cc12)OC[NH+](Cc1ccco1)C3 |
| InChI | InChI=1S/C24H20ClNO4/c1-15-18-11-21(25)23-20(13-26(14-29-23)12-17-8-5-9-28-17)22(18)30-24(27)19(15)10-16-6-3-2-4-7-16/h2-9,11H,10,12-14H2,1H3/p+1 |
| InChIKey | UCJURLPRAUDZNH-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 57.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|