C23H16NO5+ — CID 3447340
16-(furan-2-ylmethyl)-12,18-dioxa-16-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione (PubChem CID 3447340) has the molecular formula C23H16NO5+ and a molecular weight of 386.38 g/mol. Its IUPAC name is 16-(furan-2-ylmethyl)-12,18-dioxa-16-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione.
| Compound Name | 16-(furan-2-ylmethyl)-12,18-dioxa-16-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione |
|---|---|
| PubChem CID | 3447340 |
| Molecular Formula | C23H16NO5+ |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 16-(furan-2-ylmethyl)-12,18-dioxa-16-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc1c3c(ccc21)OC[NH+](Cc1ccco1)C3 |
| InChI | InChI=1S/C23H15NO5/c25-20-14-5-1-2-6-15(14)21(26)23-19(20)16-7-8-18-17(22(16)29-23)11-24(12-28-18)10-13-4-3-9-27-13/h1-9H,10-12H2/p+1 |
| InChIKey | CBBBJYYGLPEDQY-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|