C19H22NO4+ — CID 7678114
4-[[(2R)-oxolan-2-yl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one (PubChem CID 7678114) has the molecular formula C19H22NO4+ and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-[[(2R)-oxolan-2-yl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one.
| Compound Name | 4-[[(2R)-oxolan-2-yl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one |
|---|---|
| PubChem CID | 7678114 |
| Molecular Formula | C19H22NO4+ |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-[[(2R)-oxolan-2-yl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one |
| SMILES | O=c1oc2c3c(ccc2c2c1CCC2)OC[NH+](C[C@H]1CCCO1)C3 |
| InChI | InChI=1S/C19H21NO4/c21-19-15-5-1-4-13(15)14-6-7-17-16(18(14)24-19)10-20(11-23-17)9-12-3-2-8-22-12/h6-7,12H,1-5,8-11H2/p+1/t12-/m1/s1 |
| InChIKey | PUIKFQOLLPPNJP-GFCCVEGCSA-O |
| XLogP | 1.20 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|