C22H21ClNO3+ — CID 2006410
8-chloro-4-(2-phenylethyl)-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one (PubChem CID 2006410) has the molecular formula C22H21ClNO3+ and a molecular weight of 382.87 g/mol. Its IUPAC name is 8-chloro-4-(2-phenylethyl)-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one.
| Compound Name | 8-chloro-4-(2-phenylethyl)-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one |
|---|---|
| PubChem CID | 2006410 |
| Molecular Formula | C22H21ClNO3+ |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 8-chloro-4-(2-phenylethyl)-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-16-one |
| SMILES | O=c1oc2c3c(c(Cl)cc2c2c1CCC2)OC[NH+](CCc1ccccc1)C3 |
| InChI | InChI=1S/C22H20ClNO3/c23-19-11-17-15-7-4-8-16(15)22(25)27-20(17)18-12-24(13-26-21(18)19)10-9-14-5-2-1-3-6-14/h1-3,5-6,11H,4,7-10,12-13H2/p+1 |
| InChIKey | QGPKDKOLOGDSDD-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|