C23H23FNO3+ — CID 7730460
6-[2-(3-fluorophenyl)ethyl]-2-methyl-4,17-dioxa-6-azoniatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraen-16-one (PubChem CID 7730460) has the molecular formula C23H23FNO3+ and a molecular weight of 380.44 g/mol. Its IUPAC name is 6-[2-(3-fluorophenyl)ethyl]-2-methyl-4,17-dioxa-6-azoniatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraen-16-one.
| Compound Name | 6-[2-(3-fluorophenyl)ethyl]-2-methyl-4,17-dioxa-6-azoniatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraen-16-one |
|---|---|
| PubChem CID | 7730460 |
| Molecular Formula | C23H23FNO3+ |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-[2-(3-fluorophenyl)ethyl]-2-methyl-4,17-dioxa-6-azoniatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraen-16-one |
| SMILES | Cc1c2c(cc3c4c(c(=O)oc13)CCC4)C[NH+](CCc1cccc(F)c1)CO2 |
| InChI | InChI=1S/C23H22FNO3/c1-14-21-16(11-20-18-6-3-7-19(18)23(26)28-22(14)20)12-25(13-27-21)9-8-15-4-2-5-17(24)10-15/h2,4-5,10-11H,3,6-9,12-13H2,1H3/p+1 |
| InChIKey | PQHAQELSOJBJKD-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|