C20H20NO4+ — CID 7679882
9-(3-hydroxypropyl)-4-phenyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one (PubChem CID 7679882) has the molecular formula C20H20NO4+ and a molecular weight of 338.38 g/mol. Its IUPAC name is 9-(3-hydroxypropyl)-4-phenyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one.
| Compound Name | 9-(3-hydroxypropyl)-4-phenyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
|---|---|
| PubChem CID | 7679882 |
| Molecular Formula | C20H20NO4+ |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 9-(3-hydroxypropyl)-4-phenyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
| SMILES | O=c1cc(-c2ccccc2)c2ccc3c(c2o1)C[NH+](CCCO)CO3 |
| InChI | InChI=1S/C20H19NO4/c22-10-4-9-21-12-17-18(24-13-21)8-7-15-16(11-19(23)25-20(15)17)14-5-2-1-3-6-14/h1-3,5-8,11,22H,4,9-10,12-13H2/p+1 |
| InChIKey | PQYHPZXWYQGHEZ-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|