C29H27NO5 — CID 2295121
propan-2-yl (2R)-2-(2-oxo-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)-3-phenylpropanoate (PubChem CID 2295121) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is propan-2-yl (2R)-2-(2-oxo-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)-3-phenylpropanoate.
| Compound Name | propan-2-yl (2R)-2-(2-oxo-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 2295121 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | propan-2-yl (2R)-2-(2-oxo-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)[C@@H](Cc1ccccc1)N1COc2ccc3c(-c4ccccc4)cc(=O)oc3c2C1 |
| InChI | InChI=1S/C29H27NO5/c1-19(2)34-29(32)25(15-20-9-5-3-6-10-20)30-17-24-26(33-18-30)14-13-22-23(16-27(31)35-28(22)24)21-11-7-4-8-12-21/h3-14,16,19,25H,15,17-18H2,1-2H3/t25-/m1/s1 |
| InChIKey | FYFMOFDUFOICTR-RUZDIDTESA-N |
| XLogP | 5.17 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|